C14H15ClO2 — CID 115484595
(2-chloro-4,5-dimethylphenyl)-(2-methylfuran-3-yl)methanol (PubChem CID 115484595) has the molecular formula C14H15ClO2 and a molecular weight of 250.72 g/mol. Its IUPAC name is (2-chloro-4,5-dimethylphenyl)-(2-methylfuran-3-yl)methanol.
| Compound Name | (2-chloro-4,5-dimethylphenyl)-(2-methylfuran-3-yl)methanol |
|---|---|
| PubChem CID | 115484595 |
| Molecular Formula | C14H15ClO2 |
| Molecular Weight | 250.72 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (2-chloro-4,5-dimethylphenyl)-(2-methylfuran-3-yl)methanol |
| SMILES | Cc1cc(Cl)c(C(O)c2ccoc2C)cc1C |
| InChI | InChI=1S/C14H15ClO2/c1-8-6-12(13(15)7-9(8)2)14(16)11-4-5-17-10(11)3/h4-7,14,16H,1-3H3 |
| InChIKey | OKURNBZPRFKUAW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.72 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |