C31H44N4O5 — CID 11548503
N-[(E)-4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)dec-8-enyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetamide (PubChem CID 11548503) has the molecular formula C31H44N4O5 and a molecular weight of 552.72 g/mol. Its IUPAC name is N-[(E)-4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)dec-8-enyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[(E)-4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)dec-8-enyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 11548503 |
| Molecular Formula | C31H44N4O5 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | N-[(E)-4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)dec-8-enyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetamide |
| SMILES | C/C=C/CCCC(CCCNC(=O)CN1CCN(c2ccccc2OC)CC1)N1C(=O)C2C3CCC(O3)C2C1=O |
| InChI | InChI=1S/C31H44N4O5/c1-3-4-5-6-10-22(35-30(37)28-25-14-15-26(40-25)29(28)31(35)38)11-9-16-32-27(36)21-33-17-19-34(20-18-33)23-12-7-8-13-24(23)39-2/h3-4,7-8,12-13,22,25-26,28-29H,5-6,9-11,14-21H2,1-2H3,(H,32,36)/b4-3+ |
| InChIKey | ZPCBVOWFWJTWCF-ONEGZZNKSA-N |
| XLogP | 2.99 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|