C22H28N4O5 — CID 11597124
N-[(4R,7S)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-3-[4-(2-methoxyphenyl)piperazin-1-yl]propanamide (PubChem CID 11597124) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[(4R,7S)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-3-[4-(2-methoxyphenyl)piperazin-1-yl]propanamide.
| Compound Name | N-[(4R,7S)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-3-[4-(2-methoxyphenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 11597124 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-[(4R,7S)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-3-[4-(2-methoxyphenyl)piperazin-1-yl]propanamide |
| SMILES | COc1ccccc1N1CCN(CCC(=O)NN2C(=O)C3C(C2=O)[C@H]2CC[C@@H]3O2)CC1 |
| InChI | InChI=1S/C22H28N4O5/c1-30-15-5-3-2-4-14(15)25-12-10-24(11-13-25)9-8-18(27)23-26-21(28)19-16-6-7-17(31-16)20(19)22(26)29/h2-5,16-17,19-20H,6-13H2,1H3,(H,23,27)/t16-,17+,19?,20? |
| InChIKey | KQPAMKYRNYOFST-FWYSVENZSA-N |
| XLogP | 0.40 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|