C18H30ClN — CID 115485089
5-(2-chloro-4,5-dimethylphenyl)-3-methyl-N-(2-methylpropyl)pentan-1-amine (PubChem CID 115485089) has the molecular formula C18H30ClN and a molecular weight of 295.90 g/mol. Its IUPAC name is 5-(2-chloro-4,5-dimethylphenyl)-3-methyl-N-(2-methylpropyl)pentan-1-amine.
| Compound Name | 5-(2-chloro-4,5-dimethylphenyl)-3-methyl-N-(2-methylpropyl)pentan-1-amine |
|---|---|
| PubChem CID | 115485089 |
| Molecular Formula | C18H30ClN |
| Molecular Weight | 295.90 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 5-(2-chloro-4,5-dimethylphenyl)-3-methyl-N-(2-methylpropyl)pentan-1-amine |
| SMILES | Cc1cc(Cl)c(CCC(C)CCNCC(C)C)cc1C |
| InChI | InChI=1S/C18H30ClN/c1-13(2)12-20-9-8-14(3)6-7-17-10-15(4)16(5)11-18(17)19/h10-11,13-14,20H,6-9,12H2,1-5H3 |
| InChIKey | VOCOJLGUESVMRH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.90 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|