C17H26ClNO2 — CID 65303776
5-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-3-methyl-N-propylpentan-1-amine (PubChem CID 65303776) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is 5-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-3-methyl-N-propylpentan-1-amine.
| Compound Name | 5-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-3-methyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 65303776 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 5-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-3-methyl-N-propylpentan-1-amine |
| SMILES | CCCNCCC(C)CCc1cc2c(cc1Cl)OCCO2 |
| InChI | InChI=1S/C17H26ClNO2/c1-3-7-19-8-6-13(2)4-5-14-11-16-17(12-15(14)18)21-10-9-20-16/h11-13,19H,3-10H2,1-2H3 |
| InChIKey | ZZRBEXLEEIOODW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|