C14H20FNO2 — CID 115485333
4-[3,3-dimethylbutan-2-yl(methyl)amino]-2-fluorobenzoic acid (PubChem CID 115485333) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is 4-[3,3-dimethylbutan-2-yl(methyl)amino]-2-fluorobenzoic acid.
| Compound Name | 4-[3,3-dimethylbutan-2-yl(methyl)amino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 115485333 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 4-[3,3-dimethylbutan-2-yl(methyl)amino]-2-fluorobenzoic acid |
| SMILES | CC(N(C)c1ccc(C(=O)O)c(F)c1)C(C)(C)C |
| InChI | InChI=1S/C14H20FNO2/c1-9(14(2,3)4)16(5)10-6-7-11(13(17)18)12(15)8-10/h6-9H,1-5H3,(H,17,18) |
| InChIKey | OSXDDHVYWYQUAY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |