C14H20BrNO2 — CID 55222858
4-bromo-2-[3,3-dimethylbutan-2-yl(methyl)amino]benzoic acid (PubChem CID 55222858) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is 4-bromo-2-[3,3-dimethylbutan-2-yl(methyl)amino]benzoic acid.
| Compound Name | 4-bromo-2-[3,3-dimethylbutan-2-yl(methyl)amino]benzoic acid |
|---|---|
| PubChem CID | 55222858 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-bromo-2-[3,3-dimethylbutan-2-yl(methyl)amino]benzoic acid |
| SMILES | CC(N(C)c1cc(Br)ccc1C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H20BrNO2/c1-9(14(2,3)4)16(5)12-8-10(15)6-7-11(12)13(17)18/h6-9H,1-5H3,(H,17,18) |
| InChIKey | XHAMBHJHRUDPRO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |