C16H20N2O2 — CID 115485965
4-methylpentyl 4-aminoquinoline-2-carboxylate (PubChem CID 115485965) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-methylpentyl 4-aminoquinoline-2-carboxylate.
| Compound Name | 4-methylpentyl 4-aminoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 115485965 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-methylpentyl 4-aminoquinoline-2-carboxylate |
| SMILES | CC(C)CCCOC(=O)c1cc(N)c2ccccc2n1 |
| InChI | InChI=1S/C16H20N2O2/c1-11(2)6-5-9-20-16(19)15-10-13(17)12-7-3-4-8-14(12)18-15/h3-4,7-8,10-11H,5-6,9H2,1-2H3,(H2,17,18) |
| InChIKey | AYYXASAKMFTKQS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|