About 2-cyclobutylethyl 4-aminoquinoline-2-carboxylate
2-cyclobutylethyl 4-aminoquinoline-2-carboxylate (PubChem CID 106202811) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-cyclobutylethyl 4-aminoquinoline-2-carboxylate.
Molecular Properties
| Compound Name | 2-cyclobutylethyl 4-aminoquinoline-2-carboxylate |
| PubChem CID | 106202811 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-cyclobutylethyl 4-aminoquinoline-2-carboxylate |
| SMILES | Nc1cc(C(=O)OCCC2CCC2)nc2ccccc12 |
| InChI | InChI=1S/C16H18N2O2/c17-13-10-15(18-14-7-2-1-6-12(13)14)16(19)20-9-8-11-4-3-5-11/h1-2,6-7,10-11H,3-5,8-9H2,(H2,17,18) |
| InChIKey | QXPZXWSMSWDIPR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclobutylethyl 4-aminoquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylethyl 4-aminoquinoline-2-carboxylate?
The IUPAC name of 2-cyclobutylethyl 4-aminoquinoline-2-carboxylate (CID 106202811) is 2-cyclobutylethyl 4-aminoquinoline-2-carboxylate.
What is the SMILES notation for 2-cyclobutylethyl 4-aminoquinoline-2-carboxylate?
The canonical SMILES for 2-cyclobutylethyl 4-aminoquinoline-2-carboxylate is Nc1cc(C(=O)OCCC2CCC2)nc2ccccc12.
What is the InChIKey of 2-cyclobutylethyl 4-aminoquinoline-2-carboxylate?
The InChIKey is QXPZXWSMSWDIPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c17-13-10-15(18-14-7-2-1-6-12(13)14)16(19)20-9-8-11-4-3-5-11/h1-2,6-7,10-11H,3-5,8-9H2,(H2,17,18).
What are the key properties of 2-cyclobutylethyl 4-aminoquinoline-2-carboxylate?
2-cyclobutylethyl 4-aminoquinoline-2-carboxylate has a molecular weight of 270.33 g/mol, XLogP of 3.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylethyl 4-aminoquinoline-2-carboxylate is sourced from PubChem (CID 106202811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).