C10H22N2O2S — CID 115486246
[1-(2-ethylsulfonylethyl)-5-methylpyrrolidin-3-yl]methanamine (PubChem CID 115486246) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is [1-(2-ethylsulfonylethyl)-5-methylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-(2-ethylsulfonylethyl)-5-methylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 115486246 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | [1-(2-ethylsulfonylethyl)-5-methylpyrrolidin-3-yl]methanamine |
| SMILES | CCS(=O)(=O)CCN1CC(CN)CC1C |
| InChI | InChI=1S/C10H22N2O2S/c1-3-15(13,14)5-4-12-8-10(7-11)6-9(12)2/h9-10H,3-8,11H2,1-2H3 |
| InChIKey | GFMOFBXKLSBMHL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |