C10H21ClF2N2O — CID 120966625
[1-[2-(2,2-difluoroethoxy)ethyl]-5-methylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120966625) has the molecular formula C10H21ClF2N2O and a molecular weight of 258.74 g/mol. Its IUPAC name is [1-[2-(2,2-difluoroethoxy)ethyl]-5-methylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-[2-(2,2-difluoroethoxy)ethyl]-5-methylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120966625 |
| Molecular Formula | C10H21ClF2N2O |
| Molecular Weight | 258.74 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [1-[2-(2,2-difluoroethoxy)ethyl]-5-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CC1CC(CN)CN1CCOCC(F)F.Cl |
| InChI | InChI=1S/C10H20F2N2O.ClH/c1-8-4-9(5-13)6-14(8)2-3-15-7-10(11)12;/h8-10H,2-7,13H2,1H3;1H |
| InChIKey | ZFTCKWIRPCLIQM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.74 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|