C13H24F2N2O — CID 102977708
2-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 102977708) has the molecular formula C13H24F2N2O and a molecular weight of 262.34 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 102977708 |
| Molecular Formula | C13H24F2N2O |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CC1CN2CCCCC2CN1CCOCC(F)F |
| InChI | InChI=1S/C13H24F2N2O/c1-11-8-17-5-3-2-4-12(17)9-16(11)6-7-18-10-13(14)15/h11-13H,2-10H2,1H3 |
| InChIKey | NKGUGQXODFBFQM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|