C13H24F3N3 — CID 79935382
2,2,2-trifluoro-N-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]ethanamine (PubChem CID 79935382) has the molecular formula C13H24F3N3 and a molecular weight of 279.35 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]ethanamine.
| Compound Name | 2,2,2-trifluoro-N-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 79935382 |
| Molecular Formula | C13H24F3N3 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]ethanamine |
| SMILES | CC1CN2CCCCC2CN1CCNCC(F)(F)F |
| InChI | InChI=1S/C13H24F3N3/c1-11-8-19-6-3-2-4-12(19)9-18(11)7-5-17-10-13(14,15)16/h11-12,17H,2-10H2,1H3 |
| InChIKey | MLDPBYQBFYYJKN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|