C16H34N4 — CID 79924622
N',N'-dimethyl-N-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]propane-1,3-diamine (PubChem CID 79924622) has the molecular formula C16H34N4 and a molecular weight of 282.48 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 79924622 |
| Molecular Formula | C16H34N4 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.28 |
| IUPAC Name | N',N'-dimethyl-N-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]propane-1,3-diamine |
| SMILES | CC1CN2CCCCC2CN1CCNCCCN(C)C |
| InChI | InChI=1S/C16H34N4/c1-15-13-20-11-5-4-7-16(20)14-19(15)12-9-17-8-6-10-18(2)3/h15-17H,4-14H2,1-3H3 |
| InChIKey | HRIFKMMOCHOWRC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|