C17H26ClN3 — CID 79916151
4-chloro-N-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]aniline (PubChem CID 79916151) has the molecular formula C17H26ClN3 and a molecular weight of 307.87 g/mol. Its IUPAC name is 4-chloro-N-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]aniline.
| Compound Name | 4-chloro-N-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 79916151 |
| Molecular Formula | C17H26ClN3 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-chloro-N-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]aniline |
| SMILES | CC1CN2CCCCC2CN1CCNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H26ClN3/c1-14-12-21-10-3-2-4-17(21)13-20(14)11-9-19-16-7-5-15(18)6-8-16/h5-8,14,17,19H,2-4,9-13H2,1H3 |
| InChIKey | PUMAAPDFAHLDER-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |