C13H22F3N3O — CID 78992345
1-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-(2,2,2-trifluoroethylamino)ethanone (PubChem CID 78992345) has the molecular formula C13H22F3N3O and a molecular weight of 293.33 g/mol. Its IUPAC name is 1-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-(2,2,2-trifluoroethylamino)ethanone.
| Compound Name | 1-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-(2,2,2-trifluoroethylamino)ethanone |
|---|---|
| PubChem CID | 78992345 |
| Molecular Formula | C13H22F3N3O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-(2,2,2-trifluoroethylamino)ethanone |
| SMILES | CC1CN2CCCCC2CN1C(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C13H22F3N3O/c1-10-7-18-5-3-2-4-11(18)8-19(10)12(20)6-17-9-13(14,15)16/h10-11,17H,2-9H2,1H3 |
| InChIKey | JIQDIIDTCXUCFV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |