C15H28N2O — CID 79939800
2-(2-cyclopentyloxyethyl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 79939800) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-(2-cyclopentyloxyethyl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-(2-cyclopentyloxyethyl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79939800 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 2-(2-cyclopentyloxyethyl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CC1CN2CCCC2CN1CCOC1CCCC1 |
| InChI | InChI=1S/C15H28N2O/c1-13-11-17-8-4-5-14(17)12-16(13)9-10-18-15-6-2-3-7-15/h13-15H,2-12H2,1H3 |
| InChIKey | OHQQALWESQEEFQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |