C11H17N3O — CID 115486800
[5-(2-methylmorpholin-4-yl)-2-pyridinyl]methanamine (PubChem CID 115486800) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is [5-(2-methylmorpholin-4-yl)-2-pyridinyl]methanamine.
| Compound Name | [5-(2-methylmorpholin-4-yl)-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 115486800 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | [5-(2-methylmorpholin-4-yl)-2-pyridinyl]methanamine |
| SMILES | CC1CN(c2ccc(CN)nc2)CCO1 |
| InChI | InChI=1S/C11H17N3O/c1-9-8-14(4-5-15-9)11-3-2-10(6-12)13-7-11/h2-3,7,9H,4-6,8,12H2,1H3 |
| InChIKey | HFIIGGYZGADABV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |