C13H20N2O — CID 62987895
[4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanamine (PubChem CID 62987895) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is [4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanamine.
| Compound Name | [4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 62987895 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | [4-(2-methyl-1,4-oxazepan-4-yl)phenyl]methanamine |
| SMILES | CC1CN(c2ccc(CN)cc2)CCCO1 |
| InChI | InChI=1S/C13H20N2O/c1-11-10-15(7-2-8-16-11)13-5-3-12(9-14)4-6-13/h3-6,11H,2,7-10,14H2,1H3 |
| InChIKey | VJHOUZPHWGRBOH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|