C11H10N4 — CID 115487799
5-(3,5-dimethylpyrazol-1-yl)pyridine-2-carbonitrile (PubChem CID 115487799) has the molecular formula C11H10N4 and a molecular weight of 198.23 g/mol. Its IUPAC name is 5-(3,5-dimethylpyrazol-1-yl)pyridine-2-carbonitrile.
| Compound Name | 5-(3,5-dimethylpyrazol-1-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 115487799 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 5-(3,5-dimethylpyrazol-1-yl)pyridine-2-carbonitrile |
| SMILES | Cc1cc(C)n(-c2ccc(C#N)nc2)n1 |
| InChI | InChI=1S/C11H10N4/c1-8-5-9(2)15(14-8)11-4-3-10(6-12)13-7-11/h3-5,7H,1-2H3 |
| InChIKey | XBQMOWKHEZYWQE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |