About 1-(4-azidophenyl)-3,5-dimethylpyrazole
1-(4-azidophenyl)-3,5-dimethylpyrazole (PubChem CID 150446996) has the molecular formula C11H11N5
and a molecular weight of 213.24 g/mol. Its IUPAC name is 1-(4-azidophenyl)-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 1-(4-azidophenyl)-3,5-dimethylpyrazole |
| PubChem CID | 150446996 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-(4-azidophenyl)-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(-c2ccc(N=[N+]=[N-])cc2)n1 |
| InChI | InChI=1S/C11H11N5/c1-8-7-9(2)16(14-8)11-5-3-10(4-6-11)13-15-12/h3-7H,1-2H3 |
| InChIKey | HMYXULBIWQRSJC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-azidophenyl)-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-azidophenyl)-3,5-dimethylpyrazole?
The IUPAC name of 1-(4-azidophenyl)-3,5-dimethylpyrazole (CID 150446996) is 1-(4-azidophenyl)-3,5-dimethylpyrazole.
What is the SMILES notation for 1-(4-azidophenyl)-3,5-dimethylpyrazole?
The canonical SMILES for 1-(4-azidophenyl)-3,5-dimethylpyrazole is Cc1cc(C)n(-c2ccc(N=[N+]=[N-])cc2)n1.
What is the InChIKey of 1-(4-azidophenyl)-3,5-dimethylpyrazole?
The InChIKey is HMYXULBIWQRSJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5/c1-8-7-9(2)16(14-8)11-5-3-10(4-6-11)13-15-12/h3-7H,1-2H3.
What are the key properties of 1-(4-azidophenyl)-3,5-dimethylpyrazole?
1-(4-azidophenyl)-3,5-dimethylpyrazole has a molecular weight of 213.24 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-azidophenyl)-3,5-dimethylpyrazole is sourced from PubChem (CID 150446996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).