About 4-pyrazol-1-ylaniline
4-pyrazol-1-ylaniline (PubChem CID 594274) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 4-pyrazol-1-ylaniline.
Molecular Properties
| Compound Name | 4-pyrazol-1-ylaniline |
| PubChem CID | 594274 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 4-pyrazol-1-ylaniline |
| SMILES | Nc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C9H9N3/c10-8-2-4-9(5-3-8)12-7-1-6-11-12/h1-7H,10H2 |
| InChIKey | CSFIQHZIFKIQNO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-pyrazol-1-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrazol-1-ylaniline?
The IUPAC name of 4-pyrazol-1-ylaniline (CID 594274) is 4-pyrazol-1-ylaniline.
What is the SMILES notation for 4-pyrazol-1-ylaniline?
The canonical SMILES for 4-pyrazol-1-ylaniline is Nc1ccc(-n2cccn2)cc1.
What is the InChIKey of 4-pyrazol-1-ylaniline?
The InChIKey is CSFIQHZIFKIQNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c10-8-2-4-9(5-3-8)12-7-1-6-11-12/h1-7H,10H2.
What are the key properties of 4-pyrazol-1-ylaniline?
4-pyrazol-1-ylaniline has a molecular weight of 159.19 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrazol-1-ylaniline is sourced from PubChem (CID 594274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).