About 1-phenylpyrazol-3-amine
1-phenylpyrazol-3-amine (PubChem CID 594320) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 1-phenylpyrazol-3-amine.
Molecular Properties
| Compound Name | 1-phenylpyrazol-3-amine |
| PubChem CID | 594320 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 1-phenylpyrazol-3-amine |
| SMILES | Nc1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H9N3/c10-9-6-7-12(11-9)8-4-2-1-3-5-8/h1-7H,(H2,10,11) |
| InChIKey | BQQFSUKXGGGGLV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpyrazol-3-amine?
The IUPAC name of 1-phenylpyrazol-3-amine (CID 594320) is 1-phenylpyrazol-3-amine.
What is the SMILES notation for 1-phenylpyrazol-3-amine?
The canonical SMILES for 1-phenylpyrazol-3-amine is Nc1ccn(-c2ccccc2)n1.
What is the InChIKey of 1-phenylpyrazol-3-amine?
The InChIKey is BQQFSUKXGGGGLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c10-9-6-7-12(11-9)8-4-2-1-3-5-8/h1-7H,(H2,10,11).
What are the key properties of 1-phenylpyrazol-3-amine?
1-phenylpyrazol-3-amine has a molecular weight of 159.19 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpyrazol-3-amine is sourced from PubChem (CID 594320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).