C16H22N4O — CID 115492697
5-(4-butylphenoxy)-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 115492697) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-(4-butylphenoxy)-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-(4-butylphenoxy)-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 115492697 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 5-(4-butylphenoxy)-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1Oc1ccc(CCCC)cc1 |
| InChI | InChI=1S/C16H22N4O/c1-4-5-6-12-7-9-13(10-8-12)21-16-14(15(17)18)11(2)19-20(16)3/h7-10H,4-6H2,1-3H3,(H3,17,18) |
| InChIKey | FYJJEDGNKIPZBP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|