C15H20N4O2 — CID 76952111
N'-hydroxy-1,3-dimethyl-5-(4-propylphenoxy)pyrazole-4-carboximidamide (PubChem CID 76952111) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is N'-hydroxy-1,3-dimethyl-5-(4-propylphenoxy)pyrazole-4-carboximidamide.
| Compound Name | N'-hydroxy-1,3-dimethyl-5-(4-propylphenoxy)pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 76952111 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N'-hydroxy-1,3-dimethyl-5-(4-propylphenoxy)pyrazole-4-carboximidamide |
| SMILES | CCCc1ccc(Oc2c(C(N)=NO)c(C)nn2C)cc1 |
| InChI | InChI=1S/C15H20N4O2/c1-4-5-11-6-8-12(9-7-11)21-15-13(14(16)18-20)10(2)17-19(15)3/h6-9,20H,4-5H2,1-3H3,(H2,16,18) |
| InChIKey | QNJDCLXQMWYJGW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|