C14H19F3N2O — CID 115496240
N-phenyl-2-(5,5,5-trifluoropentylamino)propanamide (PubChem CID 115496240) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is N-phenyl-2-(5,5,5-trifluoropentylamino)propanamide.
| Compound Name | N-phenyl-2-(5,5,5-trifluoropentylamino)propanamide |
|---|---|
| PubChem CID | 115496240 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-phenyl-2-(5,5,5-trifluoropentylamino)propanamide |
| SMILES | CC(NCCCCC(F)(F)F)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H19F3N2O/c1-11(18-10-6-5-9-14(15,16)17)13(20)19-12-7-3-2-4-8-12/h2-4,7-8,11,18H,5-6,9-10H2,1H3,(H,19,20) |
| InChIKey | ONCOXNDLVCITKA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|