C14H13FN2OS — CID 115497489
(6-fluoro-2-pyridinyl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone (PubChem CID 115497489) has the molecular formula C14H13FN2OS and a molecular weight of 276.34 g/mol. Its IUPAC name is (6-fluoro-2-pyridinyl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone.
| Compound Name | (6-fluoro-2-pyridinyl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 115497489 |
| Molecular Formula | C14H13FN2OS |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | (6-fluoro-2-pyridinyl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cccc(F)n1)N1CCCC1c1ccsc1 |
| InChI | InChI=1S/C14H13FN2OS/c15-13-5-1-3-11(16-13)14(18)17-7-2-4-12(17)10-6-8-19-9-10/h1,3,5-6,8-9,12H,2,4,7H2 |
| InChIKey | BWAOVPZKURJFNQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|