C13H10FN5O — CID 115497637
6-fluoro-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyridine-2-carboxamide (PubChem CID 115497637) has the molecular formula C13H10FN5O and a molecular weight of 271.26 g/mol. Its IUPAC name is 6-fluoro-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 6-fluoro-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 115497637 |
| Molecular Formula | C13H10FN5O |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 6-fluoro-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCc1nnc2ccccn12)c1cccc(F)n1 |
| InChI | InChI=1S/C13H10FN5O/c14-10-5-3-4-9(16-10)13(20)15-8-12-18-17-11-6-1-2-7-19(11)12/h1-7H,8H2,(H,15,20) |
| InChIKey | QKKIHUWTLYXPJH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|