C15H15FN2O — CID 115497746
N-(3,5-dimethylphenyl)-6-fluoro-N-methylpyridine-2-carboxamide (PubChem CID 115497746) has the molecular formula C15H15FN2O and a molecular weight of 258.30 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-6-fluoro-N-methylpyridine-2-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-6-fluoro-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 115497746 |
| Molecular Formula | C15H15FN2O |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-(3,5-dimethylphenyl)-6-fluoro-N-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C)cc(N(C)C(=O)c2cccc(F)n2)c1 |
| InChI | InChI=1S/C15H15FN2O/c1-10-7-11(2)9-12(8-10)18(3)15(19)13-5-4-6-14(16)17-13/h4-9H,1-3H3 |
| InChIKey | PVMCYPGSNBJEGM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|