C14H24N4O2S — CID 115498426
N-tert-butyl-6-(4-methylsulfonylpiperazin-1-yl)pyridin-2-amine (PubChem CID 115498426) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is N-tert-butyl-6-(4-methylsulfonylpiperazin-1-yl)pyridin-2-amine.
| Compound Name | N-tert-butyl-6-(4-methylsulfonylpiperazin-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 115498426 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-tert-butyl-6-(4-methylsulfonylpiperazin-1-yl)pyridin-2-amine |
| SMILES | CC(C)(C)Nc1cccc(N2CCN(S(C)(=O)=O)CC2)n1 |
| InChI | InChI=1S/C14H24N4O2S/c1-14(2,3)16-12-6-5-7-13(15-12)17-8-10-18(11-9-17)21(4,19)20/h5-7H,8-11H2,1-4H3,(H,15,16) |
| InChIKey | IZWDYTSQJFYSLJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |