About (3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate
(3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate (PubChem CID 115498680) has the molecular formula C17H20N2O2
and a molecular weight of 284.36 g/mol. Its IUPAC name is (3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | (3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate |
| PubChem CID | 115498680 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate |
| SMILES | CCc1cccc(OC(=O)c2cccc(NC(C)C)n2)c1 |
| InChI | InChI=1S/C17H20N2O2/c1-4-13-7-5-8-14(11-13)21-17(20)15-9-6-10-16(19-15)18-12(2)3/h5-12H,4H2,1-3H3,(H,18,19) |
| InChIKey | BZCDYZWUKUEGOM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate?
The IUPAC name of (3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate (CID 115498680) is (3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate.
What is the SMILES notation for (3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate?
The canonical SMILES for (3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate is CCc1cccc(OC(=O)c2cccc(NC(C)C)n2)c1.
What is the InChIKey of (3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate?
The InChIKey is BZCDYZWUKUEGOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2/c1-4-13-7-5-8-14(11-13)21-17(20)15-9-6-10-16(19-15)18-12(2)3/h5-12H,4H2,1-3H3,(H,18,19).
What are the key properties of (3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate?
(3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate has a molecular weight of 284.36 g/mol, XLogP of 3.68, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethylphenyl) 6-(propan-2-ylamino)pyridine-2-carboxylate is sourced from PubChem (CID 115498680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).