C15H22N2O2 — CID 106205643
2-cyclobutylethyl 6-(propan-2-ylamino)pyridine-2-carboxylate (PubChem CID 106205643) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-cyclobutylethyl 6-(propan-2-ylamino)pyridine-2-carboxylate.
| Compound Name | 2-cyclobutylethyl 6-(propan-2-ylamino)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 106205643 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-cyclobutylethyl 6-(propan-2-ylamino)pyridine-2-carboxylate |
| SMILES | CC(C)Nc1cccc(C(=O)OCCC2CCC2)n1 |
| InChI | InChI=1S/C15H22N2O2/c1-11(2)16-14-8-4-7-13(17-14)15(18)19-10-9-12-5-3-6-12/h4,7-8,11-12H,3,5-6,9-10H2,1-2H3,(H,16,17) |
| InChIKey | QDKHCTVPHTYMIC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |