C11H13F3N2O2 — CID 113323737
2,2,2-trifluoroethyl 6-(propan-2-ylamino)pyridine-2-carboxylate (PubChem CID 113323737) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 6-(propan-2-ylamino)pyridine-2-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 6-(propan-2-ylamino)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 113323737 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2,2,2-trifluoroethyl 6-(propan-2-ylamino)pyridine-2-carboxylate |
| SMILES | CC(C)Nc1cccc(C(=O)OCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H13F3N2O2/c1-7(2)15-9-5-3-4-8(16-9)10(17)18-6-11(12,13)14/h3-5,7H,6H2,1-2H3,(H,15,16) |
| InChIKey | QMCVRVWDDUGMKR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |