C13H15BrN2O2 — CID 115500794
5-(2-bromo-3,3-dimethylbutyl)-2-nitrobenzonitrile (PubChem CID 115500794) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 5-(2-bromo-3,3-dimethylbutyl)-2-nitrobenzonitrile.
| Compound Name | 5-(2-bromo-3,3-dimethylbutyl)-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 115500794 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 5-(2-bromo-3,3-dimethylbutyl)-2-nitrobenzonitrile |
| SMILES | CC(C)(C)C(Br)Cc1ccc([N+](=O)[O-])c(C#N)c1 |
| InChI | InChI=1S/C13H15BrN2O2/c1-13(2,3)12(14)7-9-4-5-11(16(17)18)10(6-9)8-15/h4-6,12H,7H2,1-3H3 |
| InChIKey | OFPXGESYUJGXHH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|