C16H15FO3 — CID 115502475
2-(3-fluoro-4-methylphenyl)-4,5-dimethoxybenzaldehyde (PubChem CID 115502475) has the molecular formula C16H15FO3 and a molecular weight of 274.29 g/mol. Its IUPAC name is 2-(3-fluoro-4-methylphenyl)-4,5-dimethoxybenzaldehyde.
| Compound Name | 2-(3-fluoro-4-methylphenyl)-4,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 115502475 |
| Molecular Formula | C16H15FO3 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-(3-fluoro-4-methylphenyl)-4,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)c(-c2ccc(C)c(F)c2)cc1OC |
| InChI | InChI=1S/C16H15FO3/c1-10-4-5-11(6-14(10)17)13-8-16(20-3)15(19-2)7-12(13)9-18/h4-9H,1-3H3 |
| InChIKey | CEGULOBFAWDDNF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|