About 2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde
2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde (PubChem CID 61034520) has the molecular formula C16H15FO4
and a molecular weight of 290.29 g/mol. Its IUPAC name is 2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde.
Molecular Properties
| Compound Name | 2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde |
| PubChem CID | 61034520 |
| Molecular Formula | C16H15FO4 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde |
| SMILES | COc1ccc(-c2cc(OC)c(OC)cc2C=O)c(F)c1 |
| InChI | InChI=1S/C16H15FO4/c1-19-11-4-5-12(14(17)7-11)13-8-16(21-3)15(20-2)6-10(13)9-18/h4-9H,1-3H3 |
| InChIKey | AVRDKMCVEOELNS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde?
The IUPAC name of 2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde (CID 61034520) is 2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde.
What is the SMILES notation for 2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde?
The canonical SMILES for 2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde is COc1ccc(-c2cc(OC)c(OC)cc2C=O)c(F)c1.
What is the InChIKey of 2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde?
The InChIKey is AVRDKMCVEOELNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FO4/c1-19-11-4-5-12(14(17)7-11)13-8-16(21-3)15(20-2)6-10(13)9-18/h4-9H,1-3H3.
What are the key properties of 2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde?
2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde has a molecular weight of 290.29 g/mol, XLogP of 3.33, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoro-4-methoxyphenyl)-4,5-dimethoxybenzaldehyde is sourced from PubChem (CID 61034520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).