C12H12FN3 — CID 115502956
6-(3-fluoro-2-methylphenyl)-N-methylpyrimidin-4-amine (PubChem CID 115502956) has the molecular formula C12H12FN3 and a molecular weight of 217.25 g/mol. Its IUPAC name is 6-(3-fluoro-2-methylphenyl)-N-methylpyrimidin-4-amine.
| Compound Name | 6-(3-fluoro-2-methylphenyl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115502956 |
| Molecular Formula | C12H12FN3 |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 6-(3-fluoro-2-methylphenyl)-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(-c2cccc(F)c2C)ncn1 |
| InChI | InChI=1S/C12H12FN3/c1-8-9(4-3-5-10(8)13)11-6-12(14-2)16-7-15-11/h3-7H,1-2H3,(H,14,15,16) |
| InChIKey | YAXGEOHLLOZUJY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |