About 6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine
6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine (PubChem CID 90189659) has the molecular formula C13H15FN4
and a molecular weight of 246.29 g/mol. Its IUPAC name is 6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine |
| PubChem CID | 90189659 |
| Molecular Formula | C13H15FN4 |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine |
| SMILES | CNc1cc(-c2ccc(F)c(C)c2C)nc(N)n1 |
| InChI | InChI=1S/C13H15FN4/c1-7-8(2)10(14)5-4-9(7)11-6-12(16-3)18-13(15)17-11/h4-6H,1-3H3,(H3,15,16,17,18) |
| InChIKey | LBPIDQSWAZPHFQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine?
The IUPAC name of 6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine (CID 90189659) is 6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine.
What is the SMILES notation for 6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine?
The canonical SMILES for 6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine is CNc1cc(-c2ccc(F)c(C)c2C)nc(N)n1.
What is the InChIKey of 6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine?
The InChIKey is LBPIDQSWAZPHFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN4/c1-7-8(2)10(14)5-4-9(7)11-6-12(16-3)18-13(15)17-11/h4-6H,1-3H3,(H3,15,16,17,18).
What are the key properties of 6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine?
6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine has a molecular weight of 246.29 g/mol, XLogP of 2.52, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluoro-2,3-dimethylphenyl)-4-N-methylpyrimidine-2,4-diamine is sourced from PubChem (CID 90189659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).