About 2-methyl-5-(2,4,5-trifluorophenyl)piperidine
2-methyl-5-(2,4,5-trifluorophenyl)piperidine (PubChem CID 115503199) has the molecular formula C12H14F3N
and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-methyl-5-(2,4,5-trifluorophenyl)piperidine.
Molecular Properties
| Compound Name | 2-methyl-5-(2,4,5-trifluorophenyl)piperidine |
| PubChem CID | 115503199 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-methyl-5-(2,4,5-trifluorophenyl)piperidine |
| SMILES | CC1CCC(c2cc(F)c(F)cc2F)CN1 |
| InChI | InChI=1S/C12H14F3N/c1-7-2-3-8(6-16-7)9-4-11(14)12(15)5-10(9)13/h4-5,7-8,16H,2-3,6H2,1H3 |
| InChIKey | GYSRGYYRNZAANV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-(2,4,5-trifluorophenyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(2,4,5-trifluorophenyl)piperidine?
The IUPAC name of 2-methyl-5-(2,4,5-trifluorophenyl)piperidine (CID 115503199) is 2-methyl-5-(2,4,5-trifluorophenyl)piperidine.
What is the SMILES notation for 2-methyl-5-(2,4,5-trifluorophenyl)piperidine?
The canonical SMILES for 2-methyl-5-(2,4,5-trifluorophenyl)piperidine is CC1CCC(c2cc(F)c(F)cc2F)CN1.
What is the InChIKey of 2-methyl-5-(2,4,5-trifluorophenyl)piperidine?
The InChIKey is GYSRGYYRNZAANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N/c1-7-2-3-8(6-16-7)9-4-11(14)12(15)5-10(9)13/h4-5,7-8,16H,2-3,6H2,1H3.
What are the key properties of 2-methyl-5-(2,4,5-trifluorophenyl)piperidine?
2-methyl-5-(2,4,5-trifluorophenyl)piperidine has a molecular weight of 229.24 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(2,4,5-trifluorophenyl)piperidine is sourced from PubChem (CID 115503199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).