C15H11ClF2N2O — CID 115509147
2-(chloromethyl)-4,6-difluoro-1-(3-methoxyphenyl)benzimidazole (PubChem CID 115509147) has the molecular formula C15H11ClF2N2O and a molecular weight of 308.72 g/mol. Its IUPAC name is 2-(chloromethyl)-4,6-difluoro-1-(3-methoxyphenyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-4,6-difluoro-1-(3-methoxyphenyl)benzimidazole |
|---|---|
| PubChem CID | 115509147 |
| Molecular Formula | C15H11ClF2N2O |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-(chloromethyl)-4,6-difluoro-1-(3-methoxyphenyl)benzimidazole |
| SMILES | COc1cccc(-n2c(CCl)nc3c(F)cc(F)cc32)c1 |
| InChI | InChI=1S/C15H11ClF2N2O/c1-21-11-4-2-3-10(7-11)20-13-6-9(17)5-12(18)15(13)19-14(20)8-16/h2-7H,8H2,1H3 |
| InChIKey | UPRRAPDXOJQKIQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|