C11H9ClF3N3O — CID 83968086
3-(chloromethyl)-4-(3-methoxyphenyl)-5-(trifluoromethyl)-1,2,4-triazole (PubChem CID 83968086) has the molecular formula C11H9ClF3N3O and a molecular weight of 291.66 g/mol. Its IUPAC name is 3-(chloromethyl)-4-(3-methoxyphenyl)-5-(trifluoromethyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-(3-methoxyphenyl)-5-(trifluoromethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 83968086 |
| Molecular Formula | C11H9ClF3N3O |
| Molecular Weight | 291.66 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 3-(chloromethyl)-4-(3-methoxyphenyl)-5-(trifluoromethyl)-1,2,4-triazole |
| SMILES | COc1cccc(-n2c(CCl)nnc2C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9ClF3N3O/c1-19-8-4-2-3-7(5-8)18-9(6-12)16-17-10(18)11(13,14)15/h2-5H,6H2,1H3 |
| InChIKey | KRBVNXFAJGDBJC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.66 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|