C11H12F2N4O3 — CID 115509763
1-(3,5-difluoro-2-nitrophenyl)piperazine-2-carboxamide (PubChem CID 115509763) has the molecular formula C11H12F2N4O3 and a molecular weight of 286.24 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-nitrophenyl)piperazine-2-carboxamide.
| Compound Name | 1-(3,5-difluoro-2-nitrophenyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 115509763 |
| Molecular Formula | C11H12F2N4O3 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 1-(3,5-difluoro-2-nitrophenyl)piperazine-2-carboxamide |
| SMILES | NC(=O)C1CNCCN1c1cc(F)cc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12F2N4O3/c12-6-3-7(13)10(17(19)20)8(4-6)16-2-1-15-5-9(16)11(14)18/h3-4,9,15H,1-2,5H2,(H2,14,18) |
| InChIKey | MNLSTNOAQUEONV-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|