C10H4F2N4O2 — CID 115509936
1-(3,5-difluoro-2-nitrophenyl)imidazole-2-carbonitrile (PubChem CID 115509936) has the molecular formula C10H4F2N4O2 and a molecular weight of 250.16 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-nitrophenyl)imidazole-2-carbonitrile.
| Compound Name | 1-(3,5-difluoro-2-nitrophenyl)imidazole-2-carbonitrile |
|---|---|
| PubChem CID | 115509936 |
| Molecular Formula | C10H4F2N4O2 |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 1-(3,5-difluoro-2-nitrophenyl)imidazole-2-carbonitrile |
| SMILES | N#Cc1nccn1-c1cc(F)cc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H4F2N4O2/c11-6-3-7(12)10(16(17)18)8(4-6)15-2-1-14-9(15)5-13/h1-4H |
| InChIKey | UIXOHEVQRSMPRK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 84.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|