C13H14F2N2O2 — CID 115510106
10-ethyl-6,8-difluoro-3,3a,5,10a-tetrahydro-1H-furo[3,4-b][1,5]benzodiazepin-4-one (PubChem CID 115510106) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is 10-ethyl-6,8-difluoro-3,3a,5,10a-tetrahydro-1H-furo[3,4-b][1,5]benzodiazepin-4-one.
| Compound Name | 10-ethyl-6,8-difluoro-3,3a,5,10a-tetrahydro-1H-furo[3,4-b][1,5]benzodiazepin-4-one |
|---|---|
| PubChem CID | 115510106 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 10-ethyl-6,8-difluoro-3,3a,5,10a-tetrahydro-1H-furo[3,4-b][1,5]benzodiazepin-4-one |
| SMILES | CCN1c2cc(F)cc(F)c2NC(=O)C2COCC21 |
| InChI | InChI=1S/C13H14F2N2O2/c1-2-17-10-4-7(14)3-9(15)12(10)16-13(18)8-5-19-6-11(8)17/h3-4,8,11H,2,5-6H2,1H3,(H,16,18) |
| InChIKey | FKVLWRXXMOMMCF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |