About 7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine
7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine (PubChem CID 115510891) has the molecular formula C16H20N2OS
and a molecular weight of 288.42 g/mol. Its IUPAC name is 7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine.
Molecular Properties
| Compound Name | 7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine |
| PubChem CID | 115510891 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine |
| SMILES | CNC1(c2nc(C)cs2)CCc2ccc(OC)cc2C1 |
| InChI | InChI=1S/C16H20N2OS/c1-11-10-20-15(18-11)16(17-2)7-6-12-4-5-14(19-3)8-13(12)9-16/h4-5,8,10,17H,6-7,9H2,1-3H3 |
| InChIKey | LKRUFSJIRQLRCS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine?
The IUPAC name of 7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine (CID 115510891) is 7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine.
What is the SMILES notation for 7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine?
The canonical SMILES for 7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine is CNC1(c2nc(C)cs2)CCc2ccc(OC)cc2C1.
What is the InChIKey of 7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine?
The InChIKey is LKRUFSJIRQLRCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2OS/c1-11-10-20-15(18-11)16(17-2)7-6-12-4-5-14(19-3)8-13(12)9-16/h4-5,8,10,17H,6-7,9H2,1-3H3.
What are the key properties of 7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine?
7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine has a molecular weight of 288.42 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-N-methyl-2-(4-methyl-1,3-thiazol-2-yl)-3,4-dihydro-1H-naphthalen-2-amine is sourced from PubChem (CID 115510891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).