C11H21F3N2 — CID 115512948
1-[1-(4,4,4-trifluorobutyl)piperidin-3-yl]ethanamine (PubChem CID 115512948) has the molecular formula C11H21F3N2 and a molecular weight of 238.30 g/mol. Its IUPAC name is 1-[1-(4,4,4-trifluorobutyl)piperidin-3-yl]ethanamine.
| Compound Name | 1-[1-(4,4,4-trifluorobutyl)piperidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 115512948 |
| Molecular Formula | C11H21F3N2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-[1-(4,4,4-trifluorobutyl)piperidin-3-yl]ethanamine |
| SMILES | CC(N)C1CCCN(CCCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H21F3N2/c1-9(15)10-4-2-6-16(8-10)7-3-5-11(12,13)14/h9-10H,2-8,15H2,1H3 |
| InChIKey | XUVXZIMZJMYEQO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |