C12H22F3NO — CID 115512975
[4-methyl-1-(4,4,4-trifluorobutoxy)cyclohexyl]methanamine (PubChem CID 115512975) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is [4-methyl-1-(4,4,4-trifluorobutoxy)cyclohexyl]methanamine.
| Compound Name | [4-methyl-1-(4,4,4-trifluorobutoxy)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 115512975 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | [4-methyl-1-(4,4,4-trifluorobutoxy)cyclohexyl]methanamine |
| SMILES | CC1CCC(CN)(OCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3NO/c1-10-3-6-11(9-16,7-4-10)17-8-2-5-12(13,14)15/h10H,2-9,16H2,1H3 |
| InChIKey | JKTKZCRPRTWEDK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|