C14H17BrF3NO — CID 115513176
N-[[3-bromo-2-(4,4,4-trifluorobutoxy)phenyl]methyl]cyclopropanamine (PubChem CID 115513176) has the molecular formula C14H17BrF3NO and a molecular weight of 352.19 g/mol. Its IUPAC name is N-[[3-bromo-2-(4,4,4-trifluorobutoxy)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-bromo-2-(4,4,4-trifluorobutoxy)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 115513176 |
| Molecular Formula | C14H17BrF3NO |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-[[3-bromo-2-(4,4,4-trifluorobutoxy)phenyl]methyl]cyclopropanamine |
| SMILES | FC(F)(F)CCCOc1c(Br)cccc1CNC1CC1 |
| InChI | InChI=1S/C14H17BrF3NO/c15-12-4-1-3-10(9-19-11-5-6-11)13(12)20-8-2-7-14(16,17)18/h1,3-4,11,19H,2,5-9H2 |
| InChIKey | OLRBIYOURUDXJU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|