C15H17F3N2 — CID 64567360
N-[[1-(3,3,3-trifluoropropyl)indol-4-yl]methyl]cyclopropanamine (PubChem CID 64567360) has the molecular formula C15H17F3N2 and a molecular weight of 282.31 g/mol. Its IUPAC name is N-[[1-(3,3,3-trifluoropropyl)indol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-(3,3,3-trifluoropropyl)indol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 64567360 |
| Molecular Formula | C15H17F3N2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | N-[[1-(3,3,3-trifluoropropyl)indol-4-yl]methyl]cyclopropanamine |
| SMILES | FC(F)(F)CCn1ccc2c(CNC3CC3)cccc21 |
| InChI | InChI=1S/C15H17F3N2/c16-15(17,18)7-9-20-8-6-13-11(2-1-3-14(13)20)10-19-12-4-5-12/h1-3,6,8,12,19H,4-5,7,9-10H2 |
| InChIKey | CWQMTXNIVWMCSO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |