C12H25F3N2 — CID 115513417
N',N'-di(propan-2-yl)-N-(4,4,4-trifluorobutyl)ethane-1,2-diamine (PubChem CID 115513417) has the molecular formula C12H25F3N2 and a molecular weight of 254.34 g/mol. Its IUPAC name is N',N'-di(propan-2-yl)-N-(4,4,4-trifluorobutyl)ethane-1,2-diamine.
| Compound Name | N',N'-di(propan-2-yl)-N-(4,4,4-trifluorobutyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 115513417 |
| Molecular Formula | C12H25F3N2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | N',N'-di(propan-2-yl)-N-(4,4,4-trifluorobutyl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCNCCCC(F)(F)F)C(C)C |
| InChI | InChI=1S/C12H25F3N2/c1-10(2)17(11(3)4)9-8-16-7-5-6-12(13,14)15/h10-11,16H,5-9H2,1-4H3 |
| InChIKey | ONHAVZPXIDJMJD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|